C35H37ClFIN4O9 — CID 122482695
[[(2S,3S,4R,5R)-5-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-(4-chloro-3-fluorophenyl)methyl] benzoate (PubChem CID 122482695) has the molecular formula C35H37ClFIN4O9 and a molecular weight of 839.05 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-(4-chloro-3-fluorophenyl)methyl] benzoate.
| Compound Name | [[(2S,3S,4R,5R)-5-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-(4-chloro-3-fluorophenyl)methyl] benzoate |
|---|---|
| PubChem CID | 122482695 |
| Molecular Formula | C35H37ClFIN4O9 |
| Molecular Weight | 839.05 g/mol |
| Exact Mass | 838.13 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-(4-chloro-3-fluorophenyl)methyl] benzoate |
| SMILES | Cc1nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc2c1c(I)cn2[C@@H]1O[C@H](C(OC(=O)c2ccccc2)c2ccc(Cl)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C35H37ClFIN4O9/c1-17-23-22(38)16-41(28(23)40-31(39-17)42(32(46)50-34(2,3)4)33(47)51-35(5,6)7)29-25(44)24(43)27(48-29)26(19-13-14-20(36)21(37)15-19)49-30(45)18-11-9-8-10-12-18/h8-16,24-27,29,43-44H,1-7H3/t24-,25+,26?,27-,29+/m0/s1 |
| InChIKey | BTLMONSWGKJHKQ-LNIIHLPVSA-N |
| XLogP | 7.03 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.05 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|