C36H32Cl2N4O9 — CID 148933498
[(R)-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(hydroxyamino)-5-(2-hydroxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]-(3,4-dichlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 148933498) has the molecular formula C36H32Cl2N4O9 and a molecular weight of 735.58 g/mol. Its IUPAC name is [(R)-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(hydroxyamino)-5-(2-hydroxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]-(3,4-dichlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [(R)-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(hydroxyamino)-5-(2-hydroxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]-(3,4-dichlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 148933498 |
| Molecular Formula | C36H32Cl2N4O9 |
| Molecular Weight | 735.58 g/mol |
| Exact Mass | 734.15 |
| IUPAC Name | [(R)-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(hydroxyamino)-5-(2-hydroxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]-(3,4-dichlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@H](n2cc(CCO)c3c(NO)ncnc32)O[C@@H]1[C@H](OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C36H32Cl2N4O9/c1-19(44)48-31-30(50-35(32(31)49-20(2)45)42-17-25(14-15-43)28-33(41-47)39-18-40-34(28)42)29(24-12-13-26(37)27(38)16-24)51-36(46)23-10-8-22(9-11-23)21-6-4-3-5-7-21/h3-13,16-18,29-32,35,43,47H,14-15H2,1-2H3,(H,39,40,41)/t29-,30-,31-,32-,35-/m1/s1 |
| InChIKey | PMKFPLWCEJTBDY-PVEIOGNQSA-N |
| XLogP | 6.10 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|