C32H25ClFN3O5 — CID 142574979
[(R)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate (PubChem CID 142574979) has the molecular formula C32H25ClFN3O5 and a molecular weight of 586.02 g/mol. Its IUPAC name is [(R)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate.
| Compound Name | [(R)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 142574979 |
| Molecular Formula | C32H25ClFN3O5 |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | [(R)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate |
| SMILES | O=C(O[C@H](c1ccc2c(c1)CC2)[C@H]1O[C@@H](n2cc(F)c3c(Cl)ncnc32)[C@H](O)[C@@H]1O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25ClFN3O5/c33-29-24-23(34)15-37(30(24)36-16-35-29)31-26(39)25(38)28(41-31)27(22-13-9-19-8-12-21(19)14-22)42-32(40)20-10-6-18(7-11-20)17-4-2-1-3-5-17/h1-7,9-11,13-16,25-28,31,38-39H,8,12H2/t25-,26+,27+,28-,31+/m0/s1 |
| InChIKey | QGLWWXMCVGKYJM-JIDQCGGVSA-N |
| XLogP | 5.21 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |