C18H17ClF2N4O4 — CID 122482724
(2R,3R,4S,5R)-2-(2-amino-5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol (PubChem CID 122482724) has the molecular formula C18H17ClF2N4O4 and a molecular weight of 426.81 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-amino-5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-amino-5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 122482724 |
| Molecular Formula | C18H17ClF2N4O4 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-amino-5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
| SMILES | Cc1nc(N)nc2c1c(F)cn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H17ClF2N4O4/c1-6-11-10(21)5-25(16(11)24-18(22)23-6)17-14(28)13(27)15(29-17)12(26)7-2-3-8(19)9(20)4-7/h2-5,12-15,17,26-28H,1H3,(H2,22,23,24)/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | TYHBOTQVCFZXRX-JRBZFYFNSA-N |
| XLogP | 1.61 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |