C16H16ClFN6O4 — CID 155175203
(2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-(6-hydrazinylpurin-9-yl)oxolane-3,4-diol (PubChem CID 155175203) has the molecular formula C16H16ClFN6O4 and a molecular weight of 410.79 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-(6-hydrazinylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-(6-hydrazinylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155175203 |
| Molecular Formula | C16H16ClFN6O4 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-(6-hydrazinylpurin-9-yl)oxolane-3,4-diol |
| SMILES | NNc1ncnc2c1ncn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16ClFN6O4/c17-7-2-1-6(3-8(7)18)10(25)13-11(26)12(27)16(28-13)24-5-22-9-14(23-19)20-4-21-15(9)24/h1-5,10-13,16,25-27H,19H2,(H,20,21,23)/t10-,11+,12-,13-,16-/m1/s1 |
| InChIKey | CDDXONDHJDXCNT-ZUSNOYAUSA-N |
| XLogP | 0.26 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|