C18H17ClF3N5O7 — CID 135307595
(2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-[6-(hydroxyamino)purin-9-yl]oxolane-3,4-diol;2,2,2-trifluoroacetic acid (PubChem CID 135307595) has the molecular formula C18H17ClF3N5O7 and a molecular weight of 507.81 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-[6-(hydroxyamino)purin-9-yl]oxolane-3,4-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-[6-(hydroxyamino)purin-9-yl]oxolane-3,4-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135307595 |
| Molecular Formula | C18H17ClF3N5O7 |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-[6-(hydroxyamino)purin-9-yl]oxolane-3,4-diol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.ONc1ncnc2c1ncn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16ClN5O5.C2HF3O2/c17-8-3-1-7(2-4-8)10(23)13-11(24)12(25)16(27-13)22-6-20-9-14(21-26)18-5-19-15(9)22;3-2(4,5)1(6)7/h1-6,10-13,16,23-26H,(H,18,19,21);(H,6,7)/t10-,11+,12-,13-,16-;/m1./s1 |
| InChIKey | CXVHSSJXLLENKO-XAHDBEBOSA-N |
| XLogP | 1.27 |
| TPSA | 183.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|