C23H28ClN5O6 — CID 135307622
tert-butyl N-[[7-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylcarbamate (PubChem CID 135307622) has the molecular formula C23H28ClN5O6 and a molecular weight of 505.96 g/mol. Its IUPAC name is tert-butyl N-[[7-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[7-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 135307622 |
| Molecular Formula | C23H28ClN5O6 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | tert-butyl N-[[7-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylcarbamate |
| SMILES | CN(Nc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28ClN5O6/c1-23(2,3)35-22(33)28(4)27-19-14-9-10-29(20(14)26-11-25-19)21-17(32)16(31)18(34-21)15(30)12-5-7-13(24)8-6-12/h5-11,15-18,21,30-32H,1-4H3,(H,25,26,27)/t15?,16-,17+,18+,21+/m0/s1 |
| InChIKey | CCZBZSRFUZTGPB-PUOCNVLDSA-N |
| XLogP | 2.63 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|