C17H17ClFN5O4 — CID 135307567
(2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-(5-fluoro-4-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 135307567) has the molecular formula C17H17ClFN5O4 and a molecular weight of 409.81 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-(5-fluoro-4-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-(5-fluoro-4-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135307567 |
| Molecular Formula | C17H17ClFN5O4 |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-(5-fluoro-4-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | NNc1ncnc2c1c(F)cn2[C@@H]1O[C@H](C(O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17ClFN5O4/c18-8-3-1-7(2-4-8)11(25)14-12(26)13(27)17(28-14)24-5-9(19)10-15(23-20)21-6-22-16(10)24/h1-6,11-14,17,25-27H,20H2,(H,21,22,23)/t11?,12-,13+,14+,17+/m0/s1 |
| InChIKey | SOWWMZNHUAHSIN-OYDKQFGKSA-N |
| XLogP | 0.86 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|