C20H20ClN5O5 — CID 135317296
N-[1-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylprop-2-enamide (PubChem CID 135317296) has the molecular formula C20H20ClN5O5 and a molecular weight of 445.86 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylprop-2-enamide.
| Compound Name | N-[1-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 135317296 |
| Molecular Formula | C20H20ClN5O5 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[1-[(2R,3R,4S,5R)-5-[(4-chlorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrazolo[3,4-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ncnc2c1cnn2[C@@H]1O[C@H](C(O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20ClN5O5/c1-9(2)19(30)25-17-12-7-24-26(18(12)23-8-22-17)20-15(29)14(28)16(31-20)13(27)10-3-5-11(21)6-4-10/h3-8,13-16,20,27-29H,1H2,2H3,(H,22,23,25,30)/t13?,14-,15+,16+,20+/m0/s1 |
| InChIKey | WSBZCXIBRJXIOE-INSOGTRASA-N |
| XLogP | 1.35 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|