C17H19ClN6O4 — CID 155175225
(2R,3R,4S,5R)-2-[4-[amino(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-5-[(R)-(4-chlorophenyl)-hydroxymethyl]oxolane-3,4-diol (PubChem CID 155175225) has the molecular formula C17H19ClN6O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-[amino(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-5-[(R)-(4-chlorophenyl)-hydroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-[amino(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-5-[(R)-(4-chlorophenyl)-hydroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 155175225 |
| Molecular Formula | C17H19ClN6O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-[amino(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-5-[(R)-(4-chlorophenyl)-hydroxymethyl]oxolane-3,4-diol |
| SMILES | CN(N)c1ncnc2c1cnn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19ClN6O4/c1-23(19)15-10-6-22-24(16(10)21-7-20-15)17-13(27)12(26)14(28-17)11(25)8-2-4-9(18)5-3-8/h2-7,11-14,17,25-27H,19H2,1H3/t11-,12+,13-,14-,17-/m1/s1 |
| InChIKey | ULOCPBHHFKJWJW-QFRSUPTLSA-N |
| XLogP | 0.14 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|