C18H23ClN6O2 — CID 155706475
[5-[6-[amino(methyl)amino]purin-9-yl]oxolan-2-yl]-(4-chlorophenyl)methanol;methane (PubChem CID 155706475) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is [5-[6-[amino(methyl)amino]purin-9-yl]oxolan-2-yl]-(4-chlorophenyl)methanol;methane.
| Compound Name | [5-[6-[amino(methyl)amino]purin-9-yl]oxolan-2-yl]-(4-chlorophenyl)methanol;methane |
|---|---|
| PubChem CID | 155706475 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [5-[6-[amino(methyl)amino]purin-9-yl]oxolan-2-yl]-(4-chlorophenyl)methanol;methane |
| SMILES | C.CN(N)c1ncnc2c1ncn2C1CCC(C(O)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H19ClN6O2.CH4/c1-23(19)16-14-17(21-8-20-16)24(9-22-14)13-7-6-12(26-13)15(25)10-2-4-11(18)5-3-10;/h2-5,8-9,12-13,15,25H,6-7,19H2,1H3;1H4 |
| InChIKey | PZBCHHQPXMZYBI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|