C31H25N5O5 — CID 71130637
[(2S,5R)-5-[6-(dibenzoylamino)purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 71130637) has the molecular formula C31H25N5O5 and a molecular weight of 547.57 g/mol. Its IUPAC name is [(2S,5R)-5-[6-(dibenzoylamino)purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-5-[6-(dibenzoylamino)purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71130637 |
| Molecular Formula | C31H25N5O5 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | [(2S,5R)-5-[6-(dibenzoylamino)purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1CC[C@H](n2cnc3c(N(C(=O)c4ccccc4)C(=O)c4ccccc4)ncnc32)O1)c1ccccc1 |
| InChI | InChI=1S/C31H25N5O5/c37-29(21-10-4-1-5-11-21)36(30(38)22-12-6-2-7-13-22)28-26-27(32-19-33-28)35(20-34-26)25-17-16-24(41-25)18-40-31(39)23-14-8-3-9-15-23/h1-15,19-20,24-25H,16-18H2/t24-,25+/m0/s1 |
| InChIKey | IXDBWNJDLBOLFS-LOSJGSFVSA-N |
| XLogP | 4.85 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|