C18H17FN4O3 — CID 143308708
[(2S,5R)-4-fluoro-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl benzoate (PubChem CID 143308708) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is [(2S,5R)-4-fluoro-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-4-fluoro-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 143308708 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S,5R)-4-fluoro-5-(6-methylpurin-9-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)CC1F |
| InChI | InChI=1S/C18H17FN4O3/c1-11-15-16(21-9-20-11)23(10-22-15)17-14(19)7-13(26-17)8-25-18(24)12-5-3-2-4-6-12/h2-6,9-10,13-14,17H,7-8H2,1H3/t13-,14?,17+/m0/s1 |
| InChIKey | ZGRYPDHEXRUVMT-BHVXPOTESA-N |
| XLogP | 2.62 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |