C25H30N4O4 — CID 58681831
[(1S,2R,4S)-4-(6-methylpurin-9-yl)-2-(oxan-2-yloxymethyl)cyclopentyl]methyl benzoate (PubChem CID 58681831) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [(1S,2R,4S)-4-(6-methylpurin-9-yl)-2-(oxan-2-yloxymethyl)cyclopentyl]methyl benzoate.
| Compound Name | [(1S,2R,4S)-4-(6-methylpurin-9-yl)-2-(oxan-2-yloxymethyl)cyclopentyl]methyl benzoate |
|---|---|
| PubChem CID | 58681831 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,2R,4S)-4-(6-methylpurin-9-yl)-2-(oxan-2-yloxymethyl)cyclopentyl]methyl benzoate |
| SMILES | Cc1ncnc2c1ncn2[C@H]1C[C@@H](COC2CCCCO2)[C@@H](COC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H30N4O4/c1-17-23-24(27-15-26-17)29(16-28-23)21-11-19(13-32-22-9-5-6-10-31-22)20(12-21)14-33-25(30)18-7-3-2-4-8-18/h2-4,7-8,15-16,19-22H,5-6,9-14H2,1H3/t19-,20+,21-,22?/m0/s1 |
| InChIKey | IGWLMKVOMFRMLA-FFSRPXEDSA-N |
| XLogP | 4.10 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |