C25H23N5O4S — CID 10097063
[(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(benzoyloxymethyl)thiolan-3-yl]methyl benzoate (PubChem CID 10097063) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is [(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(benzoyloxymethyl)thiolan-3-yl]methyl benzoate.
| Compound Name | [(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(benzoyloxymethyl)thiolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 10097063 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | [(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(benzoyloxymethyl)thiolan-3-yl]methyl benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@H](COC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C25H23N5O4S/c26-22-21-23(28-14-27-22)30(15-29-21)20-11-18(12-33-24(31)16-7-3-1-4-8-16)19(35-20)13-34-25(32)17-9-5-2-6-10-17/h1-10,14-15,18-20H,11-13H2,(H2,26,27,28)/t18-,19-,20+/m1/s1 |
| InChIKey | GVVPRXOFRSBDQH-AQNXPRMDSA-N |
| XLogP | 3.74 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |