C26H24IN5O4 — CID 139922935
[4-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclopentyl]methyl benzoate (PubChem CID 139922935) has the molecular formula C26H24IN5O4 and a molecular weight of 597.41 g/mol. Its IUPAC name is [4-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclopentyl]methyl benzoate.
| Compound Name | [4-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclopentyl]methyl benzoate |
|---|---|
| PubChem CID | 139922935 |
| Molecular Formula | C26H24IN5O4 |
| Molecular Weight | 597.41 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | [4-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclopentyl]methyl benzoate |
| SMILES | Nc1nc(I)c2ncn(C3CC(COC(=O)c4ccccc4)C(COC(=O)c4ccccc4)C3)c2n1 |
| InChI | InChI=1S/C26H24IN5O4/c27-22-21-23(31-26(28)30-22)32(15-29-21)20-11-18(13-35-24(33)16-7-3-1-4-8-16)19(12-20)14-36-25(34)17-9-5-2-6-10-17/h1-10,15,18-20H,11-14H2,(H2,28,30,31) |
| InChIKey | UGSSLHZYXSNSCZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|