C27H26IN5O4 — CID 139922913
[3-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclohexyl]methyl benzoate (PubChem CID 139922913) has the molecular formula C27H26IN5O4 and a molecular weight of 611.44 g/mol. Its IUPAC name is [3-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclohexyl]methyl benzoate.
| Compound Name | [3-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclohexyl]methyl benzoate |
|---|---|
| PubChem CID | 139922913 |
| Molecular Formula | C27H26IN5O4 |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | [3-(2-amino-6-iodopurin-9-yl)-2-(benzoyloxymethyl)cyclohexyl]methyl benzoate |
| SMILES | Nc1nc(I)c2ncn(C3CCCC(COC(=O)c4ccccc4)C3COC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C27H26IN5O4/c28-23-22-24(32-27(29)31-23)33(16-30-22)21-13-7-12-19(14-36-25(34)17-8-3-1-4-9-17)20(21)15-37-26(35)18-10-5-2-6-11-18/h1-6,8-11,16,19-21H,7,12-15H2,(H2,29,31,32) |
| InChIKey | XVTUNNIEKSUMHJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|