C11H14ClN5O — CID 139633326
[(1R,2R)-2-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol (PubChem CID 139633326) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is [(1R,2R)-2-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol.
| Compound Name | [(1R,2R)-2-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 139633326 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [(1R,2R)-2-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol |
| SMILES | Nc1nc(Cl)c2ncn([C@@H]3CCC[C@H]3CO)c2n1 |
| InChI | InChI=1S/C11H14ClN5O/c12-9-8-10(16-11(13)15-9)17(5-14-8)7-3-1-2-6(7)4-18/h5-7,18H,1-4H2,(H2,13,15,16)/t6-,7+/m0/s1 |
| InChIKey | HHLAGTZBDGJZAA-NKWVEPMBSA-N |
| XLogP | 1.40 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |