C9H10ClN5 — CID 14781927
6-chloro-9-cyclobutylpurin-2-amine (PubChem CID 14781927) has the molecular formula C9H10ClN5 and a molecular weight of 223.67 g/mol. Its IUPAC name is 6-chloro-9-cyclobutylpurin-2-amine.
| Compound Name | 6-chloro-9-cyclobutylpurin-2-amine |
|---|---|
| PubChem CID | 14781927 |
| Molecular Formula | C9H10ClN5 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 6-chloro-9-cyclobutylpurin-2-amine |
| SMILES | Nc1nc(Cl)c2ncn(C3CCC3)c2n1 |
| InChI | InChI=1S/C9H10ClN5/c10-7-6-8(14-9(11)13-7)15(4-12-6)5-2-1-3-5/h4-5H,1-3H2,(H2,11,13,14) |
| InChIKey | DYYHHVVBWBPOSD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |