C26H46ClN5O2Si2 — CID 11192108
9-[(2R,4S,5S,9S)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]spiro[4.4]nonan-2-yl]-6-chloropurin-2-amine (PubChem CID 11192108) has the molecular formula C26H46ClN5O2Si2 and a molecular weight of 552.31 g/mol. Its IUPAC name is 9-[(2R,4S,5S,9S)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]spiro[4.4]nonan-2-yl]-6-chloropurin-2-amine.
| Compound Name | 9-[(2R,4S,5S,9S)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]spiro[4.4]nonan-2-yl]-6-chloropurin-2-amine |
|---|---|
| PubChem CID | 11192108 |
| Molecular Formula | C26H46ClN5O2Si2 |
| Molecular Weight | 552.31 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 9-[(2R,4S,5S,9S)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]spiro[4.4]nonan-2-yl]-6-chloropurin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]12C[C@@H](n1cnc3c(Cl)nc(N)nc31)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46ClN5O2Si2/c1-24(2,3)35(7,8)33-18-12-11-13-26(18)15-17(14-19(26)34-36(9,10)25(4,5)6)32-16-29-20-21(27)30-23(28)31-22(20)32/h16-19H,11-15H2,1-10H3,(H2,28,30,31)/t17-,18-,19-,26-/m0/s1 |
| InChIKey | SGKSRWZLSLBTCO-YEPDHIAXSA-N |
| XLogP | 7.35 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.31 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|