C18H28ClN5OSi — CID 10691994
9-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-6-chloropurin-2-amine (PubChem CID 10691994) has the molecular formula C18H28ClN5OSi and a molecular weight of 394.00 g/mol. Its IUPAC name is 9-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-6-chloropurin-2-amine.
| Compound Name | 9-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-6-chloropurin-2-amine |
|---|---|
| PubChem CID | 10691994 |
| Molecular Formula | C18H28ClN5OSi |
| Molecular Weight | 394.00 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 9-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-6-chloropurin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC=C[C@@H](n2cnc3c(Cl)nc(N)nc32)C1 |
| InChI | InChI=1S/C18H28ClN5OSi/c1-18(2,3)26(4,5)25-10-12-7-6-8-13(9-12)24-11-21-14-15(19)22-17(20)23-16(14)24/h6,8,11-13H,7,9-10H2,1-5H3,(H2,20,22,23)/t12-,13-/m1/s1 |
| InChIKey | LWVGSGQHJOPXME-CHWSQXEVSA-N |
| XLogP | 4.59 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|