C17H28N6OSi — CID 10689905
2-[(1R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 10689905) has the molecular formula C17H28N6OSi and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-[(1R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 2-[(1R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 10689905 |
| Molecular Formula | C17H28N6OSi |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[(1R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC=C[C@H](n2nc3ncnc(N)c3n2)C1 |
| InChI | InChI=1S/C17H28N6OSi/c1-17(2,3)25(4,5)24-10-12-7-6-8-13(9-12)23-21-14-15(18)19-11-20-16(14)22-23/h6,8,11-13H,7,9-10H2,1-5H3,(H2,18,19,20,22)/t12-,13-/m0/s1 |
| InChIKey | UVTXVZLDXCDXCX-STQMWFEESA-N |
| XLogP | 3.33 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|