C17H25N5O4SSi — CID 101216859
(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-6-[[tert-butyl(dimethyl)silyl]oxy(113C)methyl]-3a,4,6,6a-tetrahydro(2,3,4,5-13C4)furano[3,4-d](4,5-13C2)[1,3]dioxole-2-thione (PubChem CID 101216859) has the molecular formula C17H25N5O4SSi and a molecular weight of 428.53 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-6-[[tert-butyl(dimethyl)silyl]oxy(113C)methyl]-3a,4,6,6a-tetrahydro(2,3,4,5-13C4)furano[3,4-d](4,5-13C2)[1,3]dioxole-2-thione.
| Compound Name | (3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-6-[[tert-butyl(dimethyl)silyl]oxy(113C)methyl]-3a,4,6,6a-tetrahydro(2,3,4,5-13C4)furano[3,4-d](4,5-13C2)[1,3]dioxole-2-thione |
|---|---|
| PubChem CID | 101216859 |
| Molecular Formula | C17H25N5O4SSi |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-6-[[tert-butyl(dimethyl)silyl]oxy(113C)methyl]-3a,4,6,6a-tetrahydro(2,3,4,5-13C4)furano[3,4-d](4,5-13C2)[1,3]dioxole-2-thione |
| SMILES | CC(C)(C)[Si](C)(C)O[13CH2][13C@H]1O[13C@@H](n2cnc3c(N)ncnc32)[13C@@H]2OC(=S)O[13C@@H]21 |
| InChI | InChI=1S/C17H25N5O4SSi/c1-17(2,3)28(4,5)23-6-9-11-12(26-16(27)25-11)15(24-9)22-8-21-10-13(18)19-7-20-14(10)22/h7-9,11-12,15H,6H2,1-5H3,(H2,18,19,20)/t9-,11-,12-,15-/m1/s1/i6+1,9+1,11+1,12+1,15+1 |
| InChIKey | BPEOZWDRWRDXPZ-KMPQECEPSA-N |
| XLogP | 2.40 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|