C18H32N6O3Si — CID 146020120
(2R,3S,4S,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-ol (PubChem CID 146020120) has the molecular formula C18H32N6O3Si and a molecular weight of 408.58 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-ol.
| Compound Name | (2R,3S,4S,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 146020120 |
| Molecular Formula | C18H32N6O3Si |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (2R,3S,4S,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-ol |
| SMILES | CN(C)[C@H]1[C@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32N6O3Si/c1-18(2,3)28(6,7)26-8-11-13(23(4)5)14(25)17(27-11)24-10-22-12-15(19)20-9-21-16(12)24/h9-11,13-14,17,25H,8H2,1-7H3,(H2,19,20,21)/t11-,13-,14+,17-/m1/s1 |
| InChIKey | IGAURLMEVWYJJR-MBMVNNNZSA-N |
| XLogP | 1.62 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|