C22H34N8O3SSi — CID 146020122
O-[(2R,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-yl] imidazole-1-carbothioate (PubChem CID 146020122) has the molecular formula C22H34N8O3SSi and a molecular weight of 518.72 g/mol. Its IUPAC name is O-[(2R,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-yl] imidazole-1-carbothioate.
| Compound Name | O-[(2R,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 146020122 |
| Molecular Formula | C22H34N8O3SSi |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | O-[(2R,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(dimethylamino)oxolan-3-yl] imidazole-1-carbothioate |
| SMILES | CN(C)[C@H]1[C@H](OC(=S)n2ccnc2)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34N8O3SSi/c1-22(2,3)35(6,7)31-10-14-16(28(4)5)17(33-21(34)29-9-8-24-12-29)20(32-14)30-13-27-15-18(23)25-11-26-19(15)30/h8-9,11-14,16-17,20H,10H2,1-7H3,(H2,23,25,26)/t14-,16-,17+,20-/m1/s1 |
| InChIKey | OIADCNDULLWSLX-DFYYWFRZSA-N |
| XLogP | 2.67 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|