C26H39N5O8Si — CID 140517474
[(3S,4R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-oxopentanoyloxy)oxolan-3-yl] 4-oxopentanoate (PubChem CID 140517474) has the molecular formula C26H39N5O8Si and a molecular weight of 577.71 g/mol. Its IUPAC name is [(3S,4R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-oxopentanoyloxy)oxolan-3-yl] 4-oxopentanoate.
| Compound Name | [(3S,4R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-oxopentanoyloxy)oxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 140517474 |
| Molecular Formula | C26H39N5O8Si |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | [(3S,4R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-oxopentanoyloxy)oxolan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1C(CO[Si](C)(C)C(C)(C)C)OC(n2cnc3c(N)ncnc32)[C@@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C26H39N5O8Si/c1-15(32)8-10-18(34)38-21-17(12-36-40(6,7)26(3,4)5)37-25(22(21)39-19(35)11-9-16(2)33)31-14-30-20-23(27)28-13-29-24(20)31/h13-14,17,21-22,25H,8-12H2,1-7H3,(H2,27,28,29)/t17?,21-,22+,25?/m0/s1 |
| InChIKey | HDOFLNHBIRFCSZ-AKOMOOGNSA-N |
| XLogP | 2.89 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|