C15H27N5OSi — CID 58657723
9-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]purin-6-amine (PubChem CID 58657723) has the molecular formula C15H27N5OSi and a molecular weight of 321.50 g/mol. Its IUPAC name is 9-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]purin-6-amine.
| Compound Name | 9-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 58657723 |
| Molecular Formula | C15H27N5OSi |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 9-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]purin-6-amine |
| SMILES | CC(CCO[Si](C)(C)C(C)(C)C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H27N5OSi/c1-11(7-8-21-22(5,6)15(2,3)4)20-10-19-12-13(16)17-9-18-14(12)20/h9-11H,7-8H2,1-6H3,(H2,16,17,18) |
| InChIKey | MDELCJLBDSGTTJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|