C10H15N5O2 — CID 58657770
2-(6-aminopurin-9-yl)pentane-1,4-diol (PubChem CID 58657770) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)pentane-1,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)pentane-1,4-diol |
|---|---|
| PubChem CID | 58657770 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(6-aminopurin-9-yl)pentane-1,4-diol |
| SMILES | CC(O)CC(CO)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C10H15N5O2/c1-6(17)2-7(3-16)15-5-14-8-9(11)12-4-13-10(8)15/h4-7,16-17H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | IFYCTALKLJGQHH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |