C14H22N5NaO-2 — CID 155737450
sodium;1-(6-aminopurin-9-yl)-4-methanidylpentan-1-ol;propane (PubChem CID 155737450) has the molecular formula C14H22N5NaO-2 and a molecular weight of 299.35 g/mol. Its IUPAC name is sodium;1-(6-aminopurin-9-yl)-4-methanidylpentan-1-ol;propane.
| Compound Name | sodium;1-(6-aminopurin-9-yl)-4-methanidylpentan-1-ol;propane |
|---|---|
| PubChem CID | 155737450 |
| Molecular Formula | C14H22N5NaO-2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | sodium;1-(6-aminopurin-9-yl)-4-methanidylpentan-1-ol;propane |
| SMILES | [CH2-]C([CH2-])CCC(O)n1cnc2c(N)ncnc21.[CH2-]CC.[Na+] |
| InChI | InChI=1S/C11H15N5O.C3H7.Na/c1-7(2)3-4-8(17)16-6-15-9-10(12)13-5-14-11(9)16;1-3-2;/h5-8,17H,1-4H2,(H2,12,13,14);1,3H2,2H3;/q-2;-1;+1 |
| InChIKey | MCDCMIUOIJHTGD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|