C11H17N5O3 — CID 139454133
(3R,5R)-5-(6-aminopurin-9-yl)-5-methoxypentane-1,3-diol (PubChem CID 139454133) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is (3R,5R)-5-(6-aminopurin-9-yl)-5-methoxypentane-1,3-diol.
| Compound Name | (3R,5R)-5-(6-aminopurin-9-yl)-5-methoxypentane-1,3-diol |
|---|---|
| PubChem CID | 139454133 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3R,5R)-5-(6-aminopurin-9-yl)-5-methoxypentane-1,3-diol |
| SMILES | CO[C@H](C[C@H](O)CCO)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H17N5O3/c1-19-8(4-7(18)2-3-17)16-6-15-9-10(12)13-5-14-11(9)16/h5-8,17-18H,2-4H2,1H3,(H2,12,13,14)/t7-,8-/m1/s1 |
| InChIKey | QPYPUHOXBUDQSP-HTQZYQBOSA-N |
| XLogP | -0.31 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |