C13H17N5O3 — CID 129212729
(2R,3S)-2-[(1R)-1-(6-aminopurin-9-yl)ethoxy]-2-ethynylbutane-1,3-diol (PubChem CID 129212729) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2R,3S)-2-[(1R)-1-(6-aminopurin-9-yl)ethoxy]-2-ethynylbutane-1,3-diol.
| Compound Name | (2R,3S)-2-[(1R)-1-(6-aminopurin-9-yl)ethoxy]-2-ethynylbutane-1,3-diol |
|---|---|
| PubChem CID | 129212729 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2R,3S)-2-[(1R)-1-(6-aminopurin-9-yl)ethoxy]-2-ethynylbutane-1,3-diol |
| SMILES | C#C[C@](CO)(O[C@H](C)n1cnc2c(N)ncnc21)[C@H](C)O |
| InChI | InChI=1S/C13H17N5O3/c1-4-13(5-19,8(2)20)21-9(3)18-7-17-10-11(14)15-6-16-12(10)18/h1,6-9,19-20H,5H2,2-3H3,(H2,14,15,16)/t8-,9+,13+/m0/s1 |
| InChIKey | PLBIUVKZOYLEHW-IGJMFERPSA-N |
| XLogP | -0.31 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|