C13H21N5O2 — CID 173465384
9-[1-[(3S)-2-methoxypentan-3-yl]oxyethyl]purin-6-amine (PubChem CID 173465384) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 9-[1-[(3S)-2-methoxypentan-3-yl]oxyethyl]purin-6-amine.
| Compound Name | 9-[1-[(3S)-2-methoxypentan-3-yl]oxyethyl]purin-6-amine |
|---|---|
| PubChem CID | 173465384 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 9-[1-[(3S)-2-methoxypentan-3-yl]oxyethyl]purin-6-amine |
| SMILES | CC[C@H](OC(C)n1cnc2c(N)ncnc21)C(C)OC |
| InChI | InChI=1S/C13H21N5O2/c1-5-10(8(2)19-4)20-9(3)18-7-17-11-12(14)15-6-16-13(11)18/h6-10H,5H2,1-4H3,(H2,14,15,16)/t8?,9?,10-/m0/s1 |
| InChIKey | XBAZXLGXMKGMGT-RTBKNWGFSA-N |
| XLogP | 1.76 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |