C14H23N5O3 — CID 173465414
9-[1-[(3S)-1,2-dimethoxypentan-3-yl]oxyethyl]purin-6-amine (PubChem CID 173465414) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 9-[1-[(3S)-1,2-dimethoxypentan-3-yl]oxyethyl]purin-6-amine.
| Compound Name | 9-[1-[(3S)-1,2-dimethoxypentan-3-yl]oxyethyl]purin-6-amine |
|---|---|
| PubChem CID | 173465414 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 9-[1-[(3S)-1,2-dimethoxypentan-3-yl]oxyethyl]purin-6-amine |
| SMILES | CC[C@H](OC(C)n1cnc2c(N)ncnc21)C(COC)OC |
| InChI | InChI=1S/C14H23N5O3/c1-5-10(11(21-4)6-20-3)22-9(2)19-8-18-12-13(15)16-7-17-14(12)19/h7-11H,5-6H2,1-4H3,(H2,15,16,17)/t9?,10-,11?/m0/s1 |
| InChIKey | SVRPUNISYKIUOT-YVNMAJEFSA-N |
| XLogP | 1.38 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |