C13H23ClN5O11P3 — CID 123181386
[[2-[1-(6-aminopurin-9-yl)ethoxy]-3-chloropropoxy]-hydroxyphosphoryl] dimethoxyphosphoryl methyl phosphate (PubChem CID 123181386) has the molecular formula C13H23ClN5O11P3 and a molecular weight of 553.73 g/mol. Its IUPAC name is [[2-[1-(6-aminopurin-9-yl)ethoxy]-3-chloropropoxy]-hydroxyphosphoryl] dimethoxyphosphoryl methyl phosphate.
| Compound Name | [[2-[1-(6-aminopurin-9-yl)ethoxy]-3-chloropropoxy]-hydroxyphosphoryl] dimethoxyphosphoryl methyl phosphate |
|---|---|
| PubChem CID | 123181386 |
| Molecular Formula | C13H23ClN5O11P3 |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | [[2-[1-(6-aminopurin-9-yl)ethoxy]-3-chloropropoxy]-hydroxyphosphoryl] dimethoxyphosphoryl methyl phosphate |
| SMILES | COP(=O)(OC)OP(=O)(OC)OP(=O)(O)OCC(CCl)OC(C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H23ClN5O11P3/c1-9(19-8-18-11-12(15)16-7-17-13(11)19)28-10(5-14)6-27-31(20,21)29-33(23,26-4)30-32(22,24-2)25-3/h7-10H,5-6H2,1-4H3,(H,20,21)(H2,15,16,17) |
| InChIKey | JMUWXFPZDNSXQJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 205.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|