C10H12N5O10P2- — CID 171157408
[[2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 171157408) has the molecular formula C10H12N5O10P2- and a molecular weight of 424.18 g/mol. Its IUPAC name is [[2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 171157408 |
| Molecular Formula | C10H12N5O10P2- |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | [[2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C(C=O)OC(C=O)COP(=O)(O)OP(=O)([O-])O |
| InChI | InChI=1S/C10H13N5O10P2/c11-9-8-10(13-4-12-9)15(5-14-8)7(2-17)24-6(1-16)3-23-27(21,22)25-26(18,19)20/h1-2,4-7H,3H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/p-1 |
| InChIKey | NVPIJHRHNNQNDN-UHFFFAOYSA-M |
| XLogP | -1.72 |
| TPSA | 229.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|