C10H13N4O14P3 — CID 136731271
[hydroxy-[(2S)-3-oxo-2-[(1R)-2-oxo-1-(6-oxo-1H-purin-9-yl)ethoxy]propoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 136731271) has the molecular formula C10H13N4O14P3 and a molecular weight of 506.15 g/mol. Its IUPAC name is [hydroxy-[(2S)-3-oxo-2-[(1R)-2-oxo-1-(6-oxo-1H-purin-9-yl)ethoxy]propoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[(2S)-3-oxo-2-[(1R)-2-oxo-1-(6-oxo-1H-purin-9-yl)ethoxy]propoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136731271 |
| Molecular Formula | C10H13N4O14P3 |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | [hydroxy-[(2S)-3-oxo-2-[(1R)-2-oxo-1-(6-oxo-1H-purin-9-yl)ethoxy]propoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H](C=O)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C10H13N4O14P3/c15-1-6(3-25-30(21,22)28-31(23,24)27-29(18,19)20)26-7(2-16)14-5-13-8-9(14)11-4-12-10(8)17/h1-2,4-7H,3H2,(H,21,22)(H,23,24)(H,11,12,17)(H2,18,19,20)/t6-,7-/m1/s1 |
| InChIKey | FOMFUVPLGRLZNH-RNFRBKRXSA-N |
| XLogP | -1.26 |
| TPSA | 266.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|