C12H18N5O12P3 — CID 154937440
[[(1R,2R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 154937440) has the molecular formula C12H18N5O12P3 and a molecular weight of 517.22 g/mol. Its IUPAC name is [[(1R,2R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,2R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154937440 |
| Molecular Formula | C12H18N5O12P3 |
| Molecular Weight | 517.22 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | [[(1R,2R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](CO)[C@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H18N5O12P3/c1-5-7(3-27-31(23,24)29-32(25,26)28-30(20,21)22)6(2-18)9(5)17-4-14-8-10(17)15-12(13)16-11(8)19/h4,6-7,9,18H,1-3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,13,15,16,19)/t6-,7+,9-/m1/s1 |
| InChIKey | VUEDDSJVKJYYHK-BKPPORCPSA-N |
| XLogP | -0.62 |
| TPSA | 269.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|