C11H16N5O11P3 — CID 147435465
[[(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 147435465) has the molecular formula C11H16N5O11P3 and a molecular weight of 487.20 g/mol. Its IUPAC name is [[(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 147435465 |
| Molecular Formula | C11H16N5O11P3 |
| Molecular Weight | 487.20 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | [[(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H16N5O11P3/c1-5-6(3-25-29(21,22)27-30(23,24)26-28(18,19)20)2-7(5)16-4-13-8-9(16)14-11(12)15-10(8)17/h4,6-7H,1-3H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,12,14,15,17)/t6-,7-/m0/s1 |
| InChIKey | DVEIIQHBKPUZBK-BQBZGAKWSA-N |
| XLogP | 0.16 |
| TPSA | 249.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|