C12H18N5O11P3 — CID 156903537
[[(1R,2R,3S)-3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 156903537) has the molecular formula C12H18N5O11P3 and a molecular weight of 501.22 g/mol. Its IUPAC name is [[(1R,2R,3S)-3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,2R,3S)-3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 156903537 |
| Molecular Formula | C12H18N5O11P3 |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | [[(1R,2R,3S)-3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1[C@@H](n2cnc3c(N)ncnc32)[C@H](CO)[C@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H18N5O11P3/c1-6-8(3-26-30(22,23)28-31(24,25)27-29(19,20)21)7(2-18)10(6)17-5-16-9-11(13)14-4-15-12(9)17/h4-5,7-8,10,18H,1-3H2,(H,22,23)(H,24,25)(H2,13,14,15)(H2,19,20,21)/t7-,8+,10-/m1/s1 |
| InChIKey | BUPLEEVRTJPKEV-KHQFGBGNSA-N |
| XLogP | 0.09 |
| TPSA | 249.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|