C14H18N5O10P3 — CID 154937671
[[(1S,2R,3S)-3-(6-aminopurin-9-yl)-1-ethynyl-2-methyl-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 154937671) has the molecular formula C14H18N5O10P3 and a molecular weight of 509.25 g/mol. Its IUPAC name is [[(1S,2R,3S)-3-(6-aminopurin-9-yl)-1-ethynyl-2-methyl-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S,2R,3S)-3-(6-aminopurin-9-yl)-1-ethynyl-2-methyl-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154937671 |
| Molecular Formula | C14H18N5O10P3 |
| Molecular Weight | 509.25 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | [[(1S,2R,3S)-3-(6-aminopurin-9-yl)-1-ethynyl-2-methyl-4-methylidenecyclobutyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(=C)[C@@H](n2cnc3c(N)ncnc32)[C@@H]1C |
| InChI | InChI=1S/C14H18N5O10P3/c1-4-14(5-27-31(23,24)29-32(25,26)28-30(20,21)22)8(2)11(9(14)3)19-7-18-10-12(15)16-6-17-13(10)19/h1,6-7,9,11H,2,5H2,3H3,(H,23,24)(H,25,26)(H2,15,16,17)(H2,20,21,22)/t9-,11+,14-/m0/s1 |
| InChIKey | QIEIBDXBCAVKNW-PXWWUCIGSA-N |
| XLogP | 1.12 |
| TPSA | 229.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|