C13H18N5O12P3 — CID 123951451
[[5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123951451) has the molecular formula C13H18N5O12P3 and a molecular weight of 529.23 g/mol. Its IUPAC name is [[5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123951451 |
| Molecular Formula | C13H18N5O12P3 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | [[5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2cnc3c(N)ncnc32)C(C)C1O |
| InChI | InChI=1S/C13H18N5O12P3/c1-3-13(4-27-32(23,24)30-33(25,26)29-31(20,21)22)9(19)7(2)12(28-13)18-6-17-8-10(14)15-5-16-11(8)18/h1,5-7,9,12,19H,4H2,2H3,(H,23,24)(H,25,26)(H2,14,15,16)(H2,20,21,22) |
| InChIKey | LCYDAGUBBHYFCM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 258.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|