C10H16N4O — CID 162724389
ethane;9-propan-2-yl-1H-purin-6-one (PubChem CID 162724389) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is ethane;9-propan-2-yl-1H-purin-6-one.
| Compound Name | ethane;9-propan-2-yl-1H-purin-6-one |
|---|---|
| PubChem CID | 162724389 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | ethane;9-propan-2-yl-1H-purin-6-one |
| SMILES | CC.CC(C)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C8H10N4O.C2H6/c1-5(2)12-4-11-6-7(12)9-3-10-8(6)13;1-2/h3-5H,1-2H3,(H,9,10,13);1-2H3 |
| InChIKey | XVDZEWSNNYKEEC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |