C13H12N4O2 — CID 135987617
9-[1-(3-hydroxyphenyl)ethyl]-1H-purin-6-one (PubChem CID 135987617) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 9-[1-(3-hydroxyphenyl)ethyl]-1H-purin-6-one.
| Compound Name | 9-[1-(3-hydroxyphenyl)ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135987617 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 9-[1-(3-hydroxyphenyl)ethyl]-1H-purin-6-one |
| SMILES | CC(c1cccc(O)c1)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C13H12N4O2/c1-8(9-3-2-4-10(18)5-9)17-7-16-11-12(17)14-6-15-13(11)19/h2-8,18H,1H3,(H,14,15,19) |
| InChIKey | LKHPWOYUXMKYKR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |