C16H15N3O3 — CID 43824689
5-[1-(3-hydroxyphenyl)ethylamino]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 43824689) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-[1-(3-hydroxyphenyl)ethylamino]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-[1-(3-hydroxyphenyl)ethylamino]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 43824689 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-[1-(3-hydroxyphenyl)ethylamino]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CC(Nc1cccc2c(=O)[nH][nH]c(=O)c12)c1cccc(O)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-9(10-4-2-5-11(20)8-10)17-13-7-3-6-12-14(13)16(22)19-18-15(12)21/h2-9,17,20H,1H3,(H,18,21)(H,19,22) |
| InChIKey | FXMGUAWPTMWQMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |