C12H14N4O3 — CID 62639645
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(methylamino)propanamide (PubChem CID 62639645) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(methylamino)propanamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62639645 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C12H14N4O3/c1-6(13-2)10(17)14-8-5-3-4-7-9(8)12(19)16-15-11(7)18/h3-6,13H,1-2H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | UMTNAADBRSKRKN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |