C9H9N3O3 — CID 11521306
5-(hydroxymethylamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11521306) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-(hydroxymethylamino)-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-(hydroxymethylamino)-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 11521306 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5-(hydroxymethylamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c(NCO)cccc12 |
| InChI | InChI=1S/C9H9N3O3/c13-4-10-6-3-1-2-5-7(6)9(15)12-11-8(5)14/h1-3,10,13H,4H2,(H,11,14)(H,12,15) |
| InChIKey | SYKSAWIDJUUFQD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|