C9H7N3O2S2 — CID 102281368
(1,4-dioxo-2,3-dihydrophthalazin-5-yl)carbamodithioic acid (PubChem CID 102281368) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is (1,4-dioxo-2,3-dihydrophthalazin-5-yl)carbamodithioic acid.
| Compound Name | (1,4-dioxo-2,3-dihydrophthalazin-5-yl)carbamodithioic acid |
|---|---|
| PubChem CID | 102281368 |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | (1,4-dioxo-2,3-dihydrophthalazin-5-yl)carbamodithioic acid |
| SMILES | O=c1[nH][nH]c(=O)c2c(NC(=S)S)cccc12 |
| InChI | InChI=1S/C9H7N3O2S2/c13-7-4-2-1-3-5(10-9(15)16)6(4)8(14)12-11-7/h1-3H,(H,11,13)(H,12,14)(H2,10,15,16) |
| InChIKey | PCLGVIIHDNOUQK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|