C12H12ClN3O3 — CID 60651857
4-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)butanamide (PubChem CID 60651857) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 4-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)butanamide.
| Compound Name | 4-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)butanamide |
|---|---|
| PubChem CID | 60651857 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-chloro-N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)butanamide |
| SMILES | O=C(CCCCl)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C12H12ClN3O3/c13-6-2-5-9(17)14-8-4-1-3-7-10(8)12(19)16-15-11(7)18/h1,3-4H,2,5-6H2,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | MWTXVHMPDZRQKQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|