C17H15N3O5 — CID 110734424
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(2-methoxyphenoxy)acetamide (PubChem CID 110734424) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 110734424 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C17H15N3O5/c1-24-12-7-2-3-8-13(12)25-9-14(21)18-11-6-4-5-10-15(11)17(23)20-19-16(10)22/h2-8H,9H2,1H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | MMPBBUQQCIXWCL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |