C19H14N4O3 — CID 27190754
1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-naphthalen-1-ylurea (PubChem CID 27190754) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-naphthalen-1-ylurea.
| Compound Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 27190754 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-naphthalen-1-ylurea |
| SMILES | O=C(Nc1cccc2ccccc12)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C19H14N4O3/c24-17-13-8-4-10-15(16(13)18(25)23-22-17)21-19(26)20-14-9-3-6-11-5-1-2-7-12(11)14/h1-10H,(H,22,24)(H,23,25)(H2,20,21,26) |
| InChIKey | HZCKGWQNTLTKFD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |